C18H24O4 — CID 172746600
2-O-methyl 5-O-propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-2,5-dicarboxylate (PubChem CID 172746600) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-O-methyl 5-O-propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-2,5-dicarboxylate.
| Compound Name | 2-O-methyl 5-O-propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-2,5-dicarboxylate |
|---|---|
| PubChem CID | 172746600 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-O-methyl 5-O-propan-2-yl tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-2,5-dicarboxylate |
| SMILES | COC(=O)C12C3C=CC(C3)C1C1CC2CC1C(=O)OC(C)C |
| InChI | InChI=1S/C18H24O4/c1-9(2)22-16(19)14-8-12-7-13(14)15-10-4-5-11(6-10)18(12,15)17(20)21-3/h4-5,9-15H,6-8H2,1-3H3 |
| InChIKey | JUQFLXGVUOUNMI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|