C16H18S — CID 141433777
5-ethenyl-5-(1-ethenylcyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,3-diene (PubChem CID 141433777) has the molecular formula C16H18S and a molecular weight of 242.39 g/mol. Its IUPAC name is 5-ethenyl-5-(1-ethenylcyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,3-diene.
| Compound Name | 5-ethenyl-5-(1-ethenylcyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141433777 |
| Molecular Formula | C16H18S |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 5-ethenyl-5-(1-ethenylcyclohexa-2,4-dien-1-yl)sulfanylcyclohexa-1,3-diene |
| SMILES | C=CC1(SC2(C=C)C=CC=CC2)C=CC=CC1 |
| InChI | InChI=1S/C16H18S/c1-3-15(11-7-5-8-12-15)17-16(4-2)13-9-6-10-14-16/h3-11,13H,1-2,12,14H2 |
| InChIKey | RUSZYWJNOBYYNE-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|