C29H25N3O4S — CID 141442294
7-[3-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one (PubChem CID 141442294) has the molecular formula C29H25N3O4S and a molecular weight of 511.60 g/mol. Its IUPAC name is 7-[3-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one.
| Compound Name | 7-[3-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one |
|---|---|
| PubChem CID | 141442294 |
| Molecular Formula | C29H25N3O4S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 7-[3-[[5,6-bis(4-methylphenyl)-1,2,4-triazin-3-yl]sulfanyl]-2-hydroxypropoxy]chromen-2-one |
| SMILES | Cc1ccc(-c2nnc(SCC(O)COc3ccc4ccc(=O)oc4c3)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H25N3O4S/c1-18-3-7-21(8-4-18)27-28(22-9-5-19(2)6-10-22)31-32-29(30-27)37-17-23(33)16-35-24-13-11-20-12-14-26(34)36-25(20)15-24/h3-15,23,33H,16-17H2,1-2H3 |
| InChIKey | DEWIIBHTQJJZRK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 98.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|