C10H9NS — CID 141443315
4-phenyl-1,3-dihydropyrrole-2-thione (PubChem CID 141443315) has the molecular formula C10H9NS and a molecular weight of 175.26 g/mol. Its IUPAC name is 4-phenyl-1,3-dihydropyrrole-2-thione.
| Compound Name | 4-phenyl-1,3-dihydropyrrole-2-thione |
|---|---|
| PubChem CID | 141443315 |
| Molecular Formula | C10H9NS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | 4-phenyl-1,3-dihydropyrrole-2-thione |
| SMILES | S=C1CC(c2ccccc2)=CN1 |
| InChI | InChI=1S/C10H9NS/c12-10-6-9(7-11-10)8-4-2-1-3-5-8/h1-5,7H,6H2,(H,11,12) |
| InChIKey | YJHNFNZNARFLKW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|