C17H15NO2 — CID 169091419
4-(4-phenylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylic acid (PubChem CID 169091419) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(4-phenylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylic acid.
| Compound Name | 4-(4-phenylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 169091419 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 4-(4-phenylphenyl)-2,3-dihydro-1H-pyrrole-2-carboxylic acid |
| SMILES | O=C(O)C1CC(c2ccc(-c3ccccc3)cc2)=CN1 |
| InChI | InChI=1S/C17H15NO2/c19-17(20)16-10-15(11-18-16)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,11,16,18H,10H2,(H,19,20) |
| InChIKey | VPUSGOYZOGZLPF-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |