C16H21N5O4 — CID 141445686
1,8-dioxo-N-[3-(propan-2-ylcarbamoylamino)propyl]-2,7-dihydro-2,7-naphthyridine-3-carboxamide (PubChem CID 141445686) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 1,8-dioxo-N-[3-(propan-2-ylcarbamoylamino)propyl]-2,7-dihydro-2,7-naphthyridine-3-carboxamide.
| Compound Name | 1,8-dioxo-N-[3-(propan-2-ylcarbamoylamino)propyl]-2,7-dihydro-2,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 141445686 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1,8-dioxo-N-[3-(propan-2-ylcarbamoylamino)propyl]-2,7-dihydro-2,7-naphthyridine-3-carboxamide |
| SMILES | CC(C)NC(=O)NCCCNC(=O)c1cc2cc[nH]c(=O)c2c(=O)[nH]1 |
| InChI | InChI=1S/C16H21N5O4/c1-9(2)20-16(25)19-6-3-5-17-13(22)11-8-10-4-7-18-14(23)12(10)15(24)21-11/h4,7-9H,3,5-6H2,1-2H3,(H,17,22)(H,18,23)(H,21,24)(H2,19,20,25) |
| InChIKey | SZWLFNHHBBPPHL-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 135.95 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|