C66H63O10P — CID 141451812
tris[2,4-bis(1-phenoxyethyl)phenyl] phosphate (PubChem CID 141451812) has the molecular formula C66H63O10P and a molecular weight of 1047.19 g/mol. Its IUPAC name is tris[2,4-bis(1-phenoxyethyl)phenyl] phosphate.
| Compound Name | tris[2,4-bis(1-phenoxyethyl)phenyl] phosphate |
|---|---|
| PubChem CID | 141451812 |
| Molecular Formula | C66H63O10P |
| Molecular Weight | 1047.19 g/mol |
| Exact Mass | 1046.42 |
| IUPAC Name | tris[2,4-bis(1-phenoxyethyl)phenyl] phosphate |
| SMILES | CC(Oc1ccccc1)c1ccc(OP(=O)(Oc2ccc(C(C)Oc3ccccc3)cc2C(C)Oc2ccccc2)Oc2ccc(C(C)Oc3ccccc3)cc2C(C)Oc2ccccc2)c(C(C)Oc2ccccc2)c1 |
| InChI | InChI=1S/C66H63O10P/c1-46(68-55-25-13-7-14-26-55)52-37-40-64(61(43-52)49(4)71-58-31-19-10-20-32-58)74-77(67,75-65-41-38-53(47(2)69-56-27-15-8-16-28-56)44-62(65)50(5)72-59-33-21-11-22-34-59)76-66-42-39-54(48(3)70-57-29-17-9-18-30-57)45-63(66)51(6)73-60-35-23-12-24-36-60/h7-51H,1-6H3 |
| InChIKey | OQFJKBQZMXXSTH-UHFFFAOYSA-N |
| XLogP | 18.17 |
| TPSA | 100.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1047.19 |
| LogP ≤ 5 | 18.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|