C28H35N3OS — CID 141454703
1-[[4-tert-butyl-2-(4-methylcyclohexyl)sulfanylphenyl]methyl]-3-isoquinolin-5-ylurea (PubChem CID 141454703) has the molecular formula C28H35N3OS and a molecular weight of 461.68 g/mol. Its IUPAC name is 1-[[4-tert-butyl-2-(4-methylcyclohexyl)sulfanylphenyl]methyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[[4-tert-butyl-2-(4-methylcyclohexyl)sulfanylphenyl]methyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 141454703 |
| Molecular Formula | C28H35N3OS |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.25 |
| IUPAC Name | 1-[[4-tert-butyl-2-(4-methylcyclohexyl)sulfanylphenyl]methyl]-3-isoquinolin-5-ylurea |
| SMILES | CC1CCC(Sc2cc(C(C)(C)C)ccc2CNC(=O)Nc2cccc3cnccc23)CC1 |
| InChI | InChI=1S/C28H35N3OS/c1-19-8-12-23(13-9-19)33-26-16-22(28(2,3)4)11-10-21(26)18-30-27(32)31-25-7-5-6-20-17-29-15-14-24(20)25/h5-7,10-11,14-17,19,23H,8-9,12-13,18H2,1-4H3,(H2,30,31,32) |
| InChIKey | MVHJNZJKGYGOAL-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |