C17H40N4 — CID 141457233
1-N,1-N'-bis(3-aminopropyl)-1-N'-octylpropane-1,1-diamine (PubChem CID 141457233) has the molecular formula C17H40N4 and a molecular weight of 300.54 g/mol. Its IUPAC name is 1-N,1-N'-bis(3-aminopropyl)-1-N'-octylpropane-1,1-diamine.
| Compound Name | 1-N,1-N'-bis(3-aminopropyl)-1-N'-octylpropane-1,1-diamine |
|---|---|
| PubChem CID | 141457233 |
| Molecular Formula | C17H40N4 |
| Molecular Weight | 300.54 g/mol |
| Exact Mass | 300.33 |
| IUPAC Name | 1-N,1-N'-bis(3-aminopropyl)-1-N'-octylpropane-1,1-diamine |
| SMILES | CCCCCCCCN(CCCN)C(CC)NCCCN |
| InChI | InChI=1S/C17H40N4/c1-3-5-6-7-8-9-15-21(16-11-13-19)17(4-2)20-14-10-12-18/h17,20H,3-16,18-19H2,1-2H3 |
| InChIKey | YCJOMUBKHOTEAF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|