C12H16BFO2 — CID 141461374
[4-(4-fluorocyclohexyl)phenyl]boronic acid (PubChem CID 141461374) has the molecular formula C12H16BFO2 and a molecular weight of 222.07 g/mol. Its IUPAC name is [4-(4-fluorocyclohexyl)phenyl]boronic acid.
| Compound Name | [4-(4-fluorocyclohexyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 141461374 |
| Molecular Formula | C12H16BFO2 |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | [4-(4-fluorocyclohexyl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(C2CCC(F)CC2)cc1 |
| InChI | InChI=1S/C12H16BFO2/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16/h1-2,5-6,10,12,15-16H,3-4,7-8H2 |
| InChIKey | DPUMBPBMCIZEJE-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|