C11H17BO4S — CID 174056041
[4-(1,1-dihydroxythian-4-yl)phenyl]boronic acid (PubChem CID 174056041) has the molecular formula C11H17BO4S and a molecular weight of 256.13 g/mol. Its IUPAC name is [4-(1,1-dihydroxythian-4-yl)phenyl]boronic acid.
| Compound Name | [4-(1,1-dihydroxythian-4-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 174056041 |
| Molecular Formula | C11H17BO4S |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | [4-(1,1-dihydroxythian-4-yl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(C2CCS(O)(O)CC2)cc1 |
| InChI | InChI=1S/C11H17BO4S/c13-12(14)11-3-1-9(2-4-11)10-5-7-17(15,16)8-6-10/h1-4,10,13-16H,5-8H2 |
| InChIKey | VSBQYLMBBXRIGW-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|