C11H9N5OS — CID 141465351
1-nitroso-1,3-dipyridin-2-ylthiourea (PubChem CID 141465351) has the molecular formula C11H9N5OS and a molecular weight of 259.29 g/mol. Its IUPAC name is 1-nitroso-1,3-dipyridin-2-ylthiourea.
| Compound Name | 1-nitroso-1,3-dipyridin-2-ylthiourea |
|---|---|
| PubChem CID | 141465351 |
| Molecular Formula | C11H9N5OS |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-nitroso-1,3-dipyridin-2-ylthiourea |
| SMILES | O=NN(C(=S)Nc1ccccn1)c1ccccn1 |
| InChI | InChI=1S/C11H9N5OS/c17-15-16(10-6-2-4-8-13-10)11(18)14-9-5-1-3-7-12-9/h1-8H,(H,12,14,18) |
| InChIKey | VGUOWMKPTFFTHH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 70.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|