C22H26NO7P — CID 141471507
2-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)methylamino]ethyl dihydrogen phosphate (PubChem CID 141471507) has the molecular formula C22H26NO7P and a molecular weight of 447.42 g/mol. Its IUPAC name is 2-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)methylamino]ethyl dihydrogen phosphate.
| Compound Name | 2-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)methylamino]ethyl dihydrogen phosphate |
|---|---|
| PubChem CID | 141471507 |
| Molecular Formula | C22H26NO7P |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-[(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-2-yl)methylamino]ethyl dihydrogen phosphate |
| SMILES | Cc1c(CNCCOP(=O)(O)O)oc2c1C(=O)C(=O)c1c-2ccc2c1CCCC2(C)C |
| InChI | InChI=1S/C22H26NO7P/c1-12-16(11-23-9-10-29-31(26,27)28)30-21-14-6-7-15-13(5-4-8-22(15,2)3)18(14)20(25)19(24)17(12)21/h6-7,23H,4-5,8-11H2,1-3H3,(H2,26,27,28) |
| InChIKey | BKEACLRACCWEBR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|