C18H15NaO4 — CID 44624136
sodium 1,6-dimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-6-olate (PubChem CID 44624136) has the molecular formula C18H15NaO4 and a molecular weight of 318.30 g/mol. Its IUPAC name is sodium 1,6-dimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-6-olate.
| Compound Name | sodium 1,6-dimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-6-olate |
|---|---|
| PubChem CID | 44624136 |
| Molecular Formula | C18H15NaO4 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | sodium 1,6-dimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-6-olate |
| SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c1CCCC2(C)[O-].[Na+] |
| InChI | InChI=1S/C18H15O4.Na/c1-9-8-22-17-11-5-6-12-10(4-3-7-18(12,2)21)14(11)16(20)15(19)13(9)17;/h5-6,8H,3-4,7H2,1-2H3;/q-1;+1 |
| InChIKey | VINOSCUPJKNPDQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 70.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|