C30H32O5 — CID 132582921
(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) adamantane-1-carboxylate (PubChem CID 132582921) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is (1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) adamantane-1-carboxylate.
| Compound Name | (1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 132582921 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | (1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) adamantane-1-carboxylate |
| SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c1C(OC(=O)C13CC4CC(CC(C4)C1)C3)CCC2(C)C |
| InChI | InChI=1S/C30H32O5/c1-15-14-34-27-19-4-5-20-24(23(19)26(32)25(31)22(15)27)21(6-7-29(20,2)3)35-28(33)30-11-16-8-17(12-30)10-18(9-16)13-30/h4-5,14,16-18,21H,6-13H2,1-3H3 |
| InChIKey | UCACEFKXWDRHDP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|