C19H20O3 — CID 101001461
3,8,8-trimethyl-9,10,11,11a-tetrahydro-6H-naphtho[2,1-g][1]benzofuran-4,5-dione (PubChem CID 101001461) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3,8,8-trimethyl-9,10,11,11a-tetrahydro-6H-naphtho[2,1-g][1]benzofuran-4,5-dione.
| Compound Name | 3,8,8-trimethyl-9,10,11,11a-tetrahydro-6H-naphtho[2,1-g][1]benzofuran-4,5-dione |
|---|---|
| PubChem CID | 101001461 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 3,8,8-trimethyl-9,10,11,11a-tetrahydro-6H-naphtho[2,1-g][1]benzofuran-4,5-dione |
| SMILES | Cc1coc2c1C(=O)C(=O)C1=C2C2CCCC(C)(C)C2=CC1 |
| InChI | InChI=1S/C19H20O3/c1-10-9-22-18-14(10)17(21)16(20)12-6-7-13-11(15(12)18)5-4-8-19(13,2)3/h7,9,11H,4-6,8H2,1-3H3 |
| InChIKey | QQMKEIGVNGZHET-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|