C27H23FO5 — CID 62706199
(1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) 2-(3-fluorophenyl)acetate (PubChem CID 62706199) has the molecular formula C27H23FO5 and a molecular weight of 446.47 g/mol. Its IUPAC name is (1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) 2-(3-fluorophenyl)acetate.
| Compound Name | (1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) 2-(3-fluorophenyl)acetate |
|---|---|
| PubChem CID | 62706199 |
| Molecular Formula | C27H23FO5 |
| Molecular Weight | 446.47 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (1,6,6-trimethyl-10,11-dioxo-8,9-dihydro-7H-naphtho[1,2-g][1]benzofuran-9-yl) 2-(3-fluorophenyl)acetate |
| SMILES | Cc1coc2c1C(=O)C(=O)c1c-2ccc2c1C(OC(=O)Cc1cccc(F)c1)CCC2(C)C |
| InChI | InChI=1S/C27H23FO5/c1-14-13-32-26-17-7-8-18-23(22(17)25(31)24(30)21(14)26)19(9-10-27(18,2)3)33-20(29)12-15-5-4-6-16(28)11-15/h4-8,11,13,19H,9-10,12H2,1-3H3 |
| InChIKey | PBQAPBOBOFQEOK-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.47 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|