C77H141NO2 — CID 141478826
(12Z,15Z)-N,N-dimethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-amine (PubChem CID 141478826) has the molecular formula C77H141NO2 and a molecular weight of 1112.98 g/mol. Its IUPAC name is (12Z,15Z)-N,N-dimethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-amine.
| Compound Name | (12Z,15Z)-N,N-dimethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-amine |
|---|---|
| PubChem CID | 141478826 |
| Molecular Formula | C77H141NO2 |
| Molecular Weight | 1112.98 g/mol |
| Exact Mass | 1112.10 |
| IUPAC Name | (12Z,15Z)-N,N-dimethyl-2,3-bis[(9Z,12Z)-octadeca-9,12-dienoxy]-3-[(9Z,12Z)-octadeca-9,12-dienyl]henicosa-12,15-dien-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOC(CN(C)C)C(CCCCCCCC/C=C\C/C=C\CCCCC)(CCCCCCCC/C=C\C/C=C\CCCCC)OCCCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C77H141NO2/c1-7-11-15-19-23-27-31-35-39-43-47-51-55-59-63-67-71-77(72-68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-2,80-74-70-66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-4)76(75-78(5)6)79-73-69-65-61-57-53-49-45-41-37-33-29-25-21-17-13-9-3/h23-30,35-42,76H,7-22,31-34,43-75H2,1-6H3/b27-23-,28-24-,29-25-,30-26-,39-35-,40-36-,41-37-,42-38- |
| InChIKey | KBIVDOKGCWXYAJ-MIUGFYHFSA-N |
| XLogP | 25.72 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 65 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1112.98 |
| LogP ≤ 5 | 25.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|