C20H25N3O4 — CID 141481307
1-N,1-N'-bis[2-(4-methoxyphenyl)ethyl]-2-nitroethene-1,1-diamine (PubChem CID 141481307) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 1-N,1-N'-bis[2-(4-methoxyphenyl)ethyl]-2-nitroethene-1,1-diamine.
| Compound Name | 1-N,1-N'-bis[2-(4-methoxyphenyl)ethyl]-2-nitroethene-1,1-diamine |
|---|---|
| PubChem CID | 141481307 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 1-N,1-N'-bis[2-(4-methoxyphenyl)ethyl]-2-nitroethene-1,1-diamine |
| SMILES | COc1ccc(CCNC(=C[N+](=O)[O-])NCCc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C20H25N3O4/c1-26-18-7-3-16(4-8-18)11-13-21-20(15-23(24)25)22-14-12-17-5-9-19(27-2)10-6-17/h3-10,15,21-22H,11-14H2,1-2H3 |
| InChIKey | SMWMYZQMFHKPFQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|