C13H18O3 — CID 141487824
(1,6-dimethylcyclohexa-2,4-dien-1-yl)oxymethyl 2-methylprop-2-enoate (PubChem CID 141487824) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (1,6-dimethylcyclohexa-2,4-dien-1-yl)oxymethyl 2-methylprop-2-enoate.
| Compound Name | (1,6-dimethylcyclohexa-2,4-dien-1-yl)oxymethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141487824 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (1,6-dimethylcyclohexa-2,4-dien-1-yl)oxymethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCOC1(C)C=CC=CC1C |
| InChI | InChI=1S/C13H18O3/c1-10(2)12(14)15-9-16-13(4)8-6-5-7-11(13)3/h5-8,11H,1,9H2,2-4H3 |
| InChIKey | IQRGRPHLJZDTLY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|