C54H32N4 — CID 141493986
4-[2,3,4-tris(4-cyanophenyl)-5-(1,2,2-triphenylethenyl)phenyl]benzonitrile (PubChem CID 141493986) has the molecular formula C54H32N4 and a molecular weight of 736.88 g/mol. Its IUPAC name is 4-[2,3,4-tris(4-cyanophenyl)-5-(1,2,2-triphenylethenyl)phenyl]benzonitrile.
| Compound Name | 4-[2,3,4-tris(4-cyanophenyl)-5-(1,2,2-triphenylethenyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 141493986 |
| Molecular Formula | C54H32N4 |
| Molecular Weight | 736.88 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | 4-[2,3,4-tris(4-cyanophenyl)-5-(1,2,2-triphenylethenyl)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cc(C(=C(c3ccccc3)c3ccccc3)c3ccccc3)c(-c3ccc(C#N)cc3)c(-c3ccc(C#N)cc3)c2-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C54H32N4/c55-33-37-16-24-41(25-17-37)48-32-49(52(44-14-8-3-9-15-44)50(42-10-4-1-5-11-42)43-12-6-2-7-13-43)53(46-28-20-39(35-57)21-29-46)54(47-30-22-40(36-58)23-31-47)51(48)45-26-18-38(34-56)19-27-45/h1-32H |
| InChIKey | NTRSQUAZKGIXKK-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.88 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|