C9H3F9N2O — CID 141497618
2,4,6-tris(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 141497618) has the molecular formula C9H3F9N2O and a molecular weight of 326.12 g/mol. Its IUPAC name is 2,4,6-tris(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | 2,4,6-tris(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 141497618 |
| Molecular Formula | C9H3F9N2O |
| Molecular Weight | 326.12 g/mol |
| Exact Mass | 326.01 |
| IUPAC Name | 2,4,6-tris(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | NC(=O)c1c(C(F)(F)F)cc(C(F)(F)F)nc1C(F)(F)F |
| InChI | InChI=1S/C9H3F9N2O/c10-7(11,12)2-1-3(8(13,14)15)20-5(9(16,17)18)4(2)6(19)21/h1H,(H2,19,21) |
| InChIKey | KYYDISPFPANPNR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.12 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |