C33H38N+ — CID 141498607
benzyl-diethyl-(1,1,1-triphenylbutan-2-yl)azanium (PubChem CID 141498607) has the molecular formula C33H38N+ and a molecular weight of 448.67 g/mol. Its IUPAC name is benzyl-diethyl-(1,1,1-triphenylbutan-2-yl)azanium.
| Compound Name | benzyl-diethyl-(1,1,1-triphenylbutan-2-yl)azanium |
|---|---|
| PubChem CID | 141498607 |
| Molecular Formula | C33H38N+ |
| Molecular Weight | 448.67 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | benzyl-diethyl-(1,1,1-triphenylbutan-2-yl)azanium |
| SMILES | CCC(C(c1ccccc1)(c1ccccc1)c1ccccc1)[N+](CC)(CC)Cc1ccccc1 |
| InChI | InChI=1S/C33H38N/c1-4-32(34(5-2,6-3)27-28-19-11-7-12-20-28)33(29-21-13-8-14-22-29,30-23-15-9-16-24-30)31-25-17-10-18-26-31/h7-26,32H,4-6,27H2,1-3H3/q+1 |
| InChIKey | DHGLAFWJHDIDFX-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.67 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|