C24H26O2 — CID 139760773
2-tritylpentane-1,3-diol (PubChem CID 139760773) has the molecular formula C24H26O2 and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-tritylpentane-1,3-diol.
| Compound Name | 2-tritylpentane-1,3-diol |
|---|---|
| PubChem CID | 139760773 |
| Molecular Formula | C24H26O2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-tritylpentane-1,3-diol |
| SMILES | CCC(O)C(CO)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26O2/c1-2-23(26)22(18-25)24(19-12-6-3-7-13-19,20-14-8-4-9-15-20)21-16-10-5-11-17-21/h3-17,22-23,25-26H,2,18H2,1H3 |
| InChIKey | XZSKTHXLCYUMRQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|