C23H38N2O8 — CID 141499518
2-[methyl-[3,5,5-trimethyl-6-[methyl(2-prop-2-enoyloxyethoxycarbonyl)amino]hexyl]carbamoyl]oxyethyl prop-2-enoate (PubChem CID 141499518) has the molecular formula C23H38N2O8 and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[methyl-[3,5,5-trimethyl-6-[methyl(2-prop-2-enoyloxyethoxycarbonyl)amino]hexyl]carbamoyl]oxyethyl prop-2-enoate.
| Compound Name | 2-[methyl-[3,5,5-trimethyl-6-[methyl(2-prop-2-enoyloxyethoxycarbonyl)amino]hexyl]carbamoyl]oxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 141499518 |
| Molecular Formula | C23H38N2O8 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.26 |
| IUPAC Name | 2-[methyl-[3,5,5-trimethyl-6-[methyl(2-prop-2-enoyloxyethoxycarbonyl)amino]hexyl]carbamoyl]oxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOC(=O)N(C)CCC(C)CC(C)(C)CN(C)C(=O)OCCOC(=O)C=C |
| InChI | InChI=1S/C23H38N2O8/c1-8-19(26)30-12-14-32-21(28)24(6)11-10-18(3)16-23(4,5)17-25(7)22(29)33-15-13-31-20(27)9-2/h8-9,18H,1-2,10-17H2,3-7H3 |
| InChIKey | BMRZFHNAJJXQBD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|