C19H30N2O3 — CID 141499862
[2-acetyl-5-[1-(diethylamino)ethyl]phenyl] N,N-diethylcarbamate (PubChem CID 141499862) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is [2-acetyl-5-[1-(diethylamino)ethyl]phenyl] N,N-diethylcarbamate.
| Compound Name | [2-acetyl-5-[1-(diethylamino)ethyl]phenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 141499862 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | [2-acetyl-5-[1-(diethylamino)ethyl]phenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1cc(C(C)N(CC)CC)ccc1C(C)=O |
| InChI | InChI=1S/C19H30N2O3/c1-7-20(8-2)14(5)16-11-12-17(15(6)22)18(13-16)24-19(23)21(9-3)10-4/h11-14H,7-10H2,1-6H3 |
| InChIKey | UBZYEELQJAPZJK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |