C18H13ClF3NO3S — CID 14157400
N-(3-chloro-2-methylphenyl)sulfonyl-N-prop-2-ynyl-2-(trifluoromethyl)benzamide (PubChem CID 14157400) has the molecular formula C18H13ClF3NO3S and a molecular weight of 415.82 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)sulfonyl-N-prop-2-ynyl-2-(trifluoromethyl)benzamide.
| Compound Name | N-(3-chloro-2-methylphenyl)sulfonyl-N-prop-2-ynyl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 14157400 |
| Molecular Formula | C18H13ClF3NO3S |
| Molecular Weight | 415.82 g/mol |
| Exact Mass | 415.03 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)sulfonyl-N-prop-2-ynyl-2-(trifluoromethyl)benzamide |
| SMILES | C#CCN(C(=O)c1ccccc1C(F)(F)F)S(=O)(=O)c1cccc(Cl)c1C |
| InChI | InChI=1S/C18H13ClF3NO3S/c1-3-11-23(27(25,26)16-10-6-9-15(19)12(16)2)17(24)13-7-4-5-8-14(13)18(20,21)22/h1,4-10H,11H2,2H3 |
| InChIKey | GAPUECRJAOPEFJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.82 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|