C22H32O4 — CID 14159810
[5-oxo-4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-2-yl] acetate (PubChem CID 14159810) has the molecular formula C22H32O4 and a molecular weight of 360.49 g/mol. Its IUPAC name is [5-oxo-4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-2-yl] acetate.
| Compound Name | [5-oxo-4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-2-yl] acetate |
|---|---|
| PubChem CID | 14159810 |
| Molecular Formula | C22H32O4 |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | [5-oxo-4-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-2H-furan-2-yl] acetate |
| SMILES | CC(=O)OC1C=C(CC/C=C(\C)CC/C=C(\C)CCC=C(C)C)C(=O)O1 |
| InChI | InChI=1S/C22H32O4/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-20-15-21(25-19(5)23)26-22(20)24/h9,11,13,15,21H,6-8,10,12,14H2,1-5H3/b17-11+,18-13+ |
| InChIKey | RKRFHXVVRCHNSV-OUBUNXTGSA-N |
| XLogP | 5.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|