C32H58O3Sn — CID 14194132
tributyl-[[(E,4S,5S,6R)-4,6-dimethyl-5-(phenylmethoxymethoxy)non-2-en-4-yl]oxymethyl]stannane (PubChem CID 14194132) has the molecular formula C32H58O3Sn and a molecular weight of 609.52 g/mol. Its IUPAC name is tributyl-[[(E,4S,5S,6R)-4,6-dimethyl-5-(phenylmethoxymethoxy)non-2-en-4-yl]oxymethyl]stannane.
| Compound Name | tributyl-[[(E,4S,5S,6R)-4,6-dimethyl-5-(phenylmethoxymethoxy)non-2-en-4-yl]oxymethyl]stannane |
|---|---|
| PubChem CID | 14194132 |
| Molecular Formula | C32H58O3Sn |
| Molecular Weight | 609.52 g/mol |
| Exact Mass | 610.34 |
| IUPAC Name | tributyl-[[(E,4S,5S,6R)-4,6-dimethyl-5-(phenylmethoxymethoxy)non-2-en-4-yl]oxymethyl]stannane |
| SMILES | C/C=C/[C@](C)(OC[Sn](CCCC)(CCCC)CCCC)[C@@H](OCOCc1ccccc1)[C@H](C)CCC |
| InChI | InChI=1S/C20H31O3.3C4H9.Sn/c1-6-11-17(3)19(20(4,21-5)14-7-2)23-16-22-15-18-12-9-8-10-13-18;3*1-3-4-2;/h7-10,12-14,17,19H,5-6,11,15-16H2,1-4H3;3*1,3-4H2,2H3;/b14-7+;;;;/t17-,19+,20+;;;;/m1..../s1 |
| InChIKey | QKIOIOJPQFKBIB-IWESLANJSA-N |
| XLogP | 9.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.52 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|