C23H32N2O5 — CID 142001449
3-[4-[4-[(2-cyclohexylacetyl)amino]piperidine-1-carbonyl]oxyphenyl]propanoic acid (PubChem CID 142001449) has the molecular formula C23H32N2O5 and a molecular weight of 416.52 g/mol. Its IUPAC name is 3-[4-[4-[(2-cyclohexylacetyl)amino]piperidine-1-carbonyl]oxyphenyl]propanoic acid.
| Compound Name | 3-[4-[4-[(2-cyclohexylacetyl)amino]piperidine-1-carbonyl]oxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 142001449 |
| Molecular Formula | C23H32N2O5 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 3-[4-[4-[(2-cyclohexylacetyl)amino]piperidine-1-carbonyl]oxyphenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(OC(=O)N2CCC(NC(=O)CC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C23H32N2O5/c26-21(16-18-4-2-1-3-5-18)24-19-12-14-25(15-13-19)23(29)30-20-9-6-17(7-10-20)8-11-22(27)28/h6-7,9-10,18-19H,1-5,8,11-16H2,(H,24,26)(H,27,28) |
| InChIKey | ADSXDMVJOGKEQW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |