About cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine
cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine (PubChem CID 142003483) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine.
Molecular Properties
| Compound Name | cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine |
| PubChem CID | 142003483 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine |
| SMILES | NC1CCCCC1.[H]/N=C/c1ccc(C)c2ccccc12 |
| InChI | InChI=1S/C12H11N.C6H13N/c1-9-6-7-10(8-13)12-5-3-2-4-11(9)12;7-6-4-2-1-3-5-6/h2-8,13H,1H3;6H,1-5,7H2/b13-8+; |
| InChIKey | CBSFDUHYBYNVRN-FNXZNAJJSA-N |
| XLogP | 4.42 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine?
The IUPAC name of cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine (CID 142003483) is cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine.
What is the SMILES notation for cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine?
The canonical SMILES for cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine is NC1CCCCC1.[H]/N=C/c1ccc(C)c2ccccc12.
What is the InChIKey of cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine?
The InChIKey is CBSFDUHYBYNVRN-FNXZNAJJSA-N. The full InChI is InChI=1S/C12H11N.C6H13N/c1-9-6-7-10(8-13)12-5-3-2-4-11(9)12;7-6-4-2-1-3-5-6/h2-8,13H,1H3;6H,1-5,7H2/b13-8+;.
What are the key properties of cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine?
cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine has a molecular weight of 268.40 g/mol, XLogP of 4.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanamine;(4-methylnaphthalen-1-yl)methanimine is sourced from PubChem (CID 142003483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).