C34H42N4O3 — CID 142005665
(2R)-N-[2-[2-(benzenecarboximidoyl)-N-methylanilino]-2-oxoethyl]-N'-benzyl-2-(2-methylpropyl)butanediamide;prop-1-ene (PubChem CID 142005665) has the molecular formula C34H42N4O3 and a molecular weight of 554.74 g/mol. Its IUPAC name is (2R)-N-[2-[2-(benzenecarboximidoyl)-N-methylanilino]-2-oxoethyl]-N'-benzyl-2-(2-methylpropyl)butanediamide;prop-1-ene.
| Compound Name | (2R)-N-[2-[2-(benzenecarboximidoyl)-N-methylanilino]-2-oxoethyl]-N'-benzyl-2-(2-methylpropyl)butanediamide;prop-1-ene |
|---|---|
| PubChem CID | 142005665 |
| Molecular Formula | C34H42N4O3 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.33 |
| IUPAC Name | (2R)-N-[2-[2-(benzenecarboximidoyl)-N-methylanilino]-2-oxoethyl]-N'-benzyl-2-(2-methylpropyl)butanediamide;prop-1-ene |
| SMILES | C=CC.[H]/N=C(\c1ccccc1)c1ccccc1N(C)C(=O)CNC(=O)[C@@H](CC(=O)NCc1ccccc1)CC(C)C |
| InChI | InChI=1S/C31H36N4O3.C3H6/c1-22(2)18-25(19-28(36)33-20-23-12-6-4-7-13-23)31(38)34-21-29(37)35(3)27-17-11-10-16-26(27)30(32)24-14-8-5-9-15-24;1-3-2/h4-17,22,25,32H,18-21H2,1-3H3,(H,33,36)(H,34,38);3H,1H2,2H3/b32-30+;/t25-;/m1./s1 |
| InChIKey | JPGHSWOSJYIASR-OXZDUZLVSA-N |
| XLogP | 5.74 |
| TPSA | 102.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|