C18H26O3S — CID 142005736
(4-tert-butyl-2-hydroxyphenyl) (Z)-3-methyl-6-methylsulfanylhex-5-enoate (PubChem CID 142005736) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is (4-tert-butyl-2-hydroxyphenyl) (Z)-3-methyl-6-methylsulfanylhex-5-enoate.
| Compound Name | (4-tert-butyl-2-hydroxyphenyl) (Z)-3-methyl-6-methylsulfanylhex-5-enoate |
|---|---|
| PubChem CID | 142005736 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | (4-tert-butyl-2-hydroxyphenyl) (Z)-3-methyl-6-methylsulfanylhex-5-enoate |
| SMILES | CS/C=C\CC(C)CC(=O)Oc1ccc(C(C)(C)C)cc1O |
| InChI | InChI=1S/C18H26O3S/c1-13(7-6-10-22-5)11-17(20)21-16-9-8-14(12-15(16)19)18(2,3)4/h6,8-10,12-13,19H,7,11H2,1-5H3/b10-6- |
| InChIKey | DAVDAWYSIWCCOM-POHAHGRESA-N |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|