C21H14F3NO5 — CID 142008672
6-hydroxy-5-[(3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]oxynaphtho[2,3-f]quinoline-7,12-dione (PubChem CID 142008672) has the molecular formula C21H14F3NO5 and a molecular weight of 417.34 g/mol. Its IUPAC name is 6-hydroxy-5-[(3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]oxynaphtho[2,3-f]quinoline-7,12-dione.
| Compound Name | 6-hydroxy-5-[(3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]oxynaphtho[2,3-f]quinoline-7,12-dione |
|---|---|
| PubChem CID | 142008672 |
| Molecular Formula | C21H14F3NO5 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | 6-hydroxy-5-[(3S)-4,4,4-trifluoro-3-hydroxybutan-2-yl]oxynaphtho[2,3-f]quinoline-7,12-dione |
| SMILES | CC(Oc1c(O)c2c(c3cccnc13)C(=O)c1ccccc1C2=O)[C@H](O)C(F)(F)F |
| InChI | InChI=1S/C21H14F3NO5/c1-9(20(29)21(22,23)24)30-19-15-12(7-4-8-25-15)13-14(18(19)28)17(27)11-6-3-2-5-10(11)16(13)26/h2-9,20,28-29H,1H3/t9?,20-/m0/s1 |
| InChIKey | HMOZNRODOJXQRN-REVXXAFSSA-N |
| XLogP | 3.41 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|