C23H20FNO7 — CID 142008657
5-(2-fluoro-3,4,5-trihydroxyhexoxy)-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione (PubChem CID 142008657) has the molecular formula C23H20FNO7 and a molecular weight of 441.41 g/mol. Its IUPAC name is 5-(2-fluoro-3,4,5-trihydroxyhexoxy)-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione.
| Compound Name | 5-(2-fluoro-3,4,5-trihydroxyhexoxy)-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione |
|---|---|
| PubChem CID | 142008657 |
| Molecular Formula | C23H20FNO7 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | 5-(2-fluoro-3,4,5-trihydroxyhexoxy)-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione |
| SMILES | CC(O)C(O)C(O)C(F)COc1c(O)c2c(c3cccnc13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H20FNO7/c1-10(26)18(27)21(30)14(24)9-32-23-17-13(7-4-8-25-17)15-16(22(23)31)20(29)12-6-3-2-5-11(12)19(15)28/h2-8,10,14,18,21,26-27,30-31H,9H2,1H3 |
| InChIKey | JESLVAHNDXJCHH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 137.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|