C23H19FN2O6 — CID 142008684
5-(5-amino-3-fluoro-4-hydroxy-6-methyloxan-2-yl)oxy-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione (PubChem CID 142008684) has the molecular formula C23H19FN2O6 and a molecular weight of 438.41 g/mol. Its IUPAC name is 5-(5-amino-3-fluoro-4-hydroxy-6-methyloxan-2-yl)oxy-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione.
| Compound Name | 5-(5-amino-3-fluoro-4-hydroxy-6-methyloxan-2-yl)oxy-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione |
|---|---|
| PubChem CID | 142008684 |
| Molecular Formula | C23H19FN2O6 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | 5-(5-amino-3-fluoro-4-hydroxy-6-methyloxan-2-yl)oxy-6-hydroxynaphtho[2,3-f]quinoline-7,12-dione |
| SMILES | CC1OC(Oc2c(O)c3c(c4cccnc24)C(=O)c2ccccc2C3=O)C(F)C(O)C1N |
| InChI | InChI=1S/C23H19FN2O6/c1-9-16(25)21(30)15(24)23(31-9)32-22-17-12(7-4-8-26-17)13-14(20(22)29)19(28)11-6-3-2-5-10(11)18(13)27/h2-9,15-16,21,23,29-30H,25H2,1H3 |
| InChIKey | YQKAHMQLSNXVDH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 131.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|