C24H23NO8 — CID 142008654
6-hydroxy-5-(3,4,5-trihydroxy-2-methoxyhexoxy)naphtho[2,3-f]quinoline-7,12-dione (PubChem CID 142008654) has the molecular formula C24H23NO8 and a molecular weight of 453.45 g/mol. Its IUPAC name is 6-hydroxy-5-(3,4,5-trihydroxy-2-methoxyhexoxy)naphtho[2,3-f]quinoline-7,12-dione.
| Compound Name | 6-hydroxy-5-(3,4,5-trihydroxy-2-methoxyhexoxy)naphtho[2,3-f]quinoline-7,12-dione |
|---|---|
| PubChem CID | 142008654 |
| Molecular Formula | C24H23NO8 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | 6-hydroxy-5-(3,4,5-trihydroxy-2-methoxyhexoxy)naphtho[2,3-f]quinoline-7,12-dione |
| SMILES | COC(COc1c(O)c2c(c3cccnc13)C(=O)c1ccccc1C2=O)C(O)C(O)C(C)O |
| InChI | InChI=1S/C24H23NO8/c1-11(26)19(27)22(30)15(32-2)10-33-24-18-14(8-5-9-25-18)16-17(23(24)31)21(29)13-7-4-3-6-12(13)20(16)28/h3-9,11,15,19,22,26-27,30-31H,10H2,1-2H3 |
| InChIKey | CBTOITWVBSCAHK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|