C17H23F3N2O — CID 142009385
N-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)benzamide;prop-1-ene (PubChem CID 142009385) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is N-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)benzamide;prop-1-ene.
| Compound Name | N-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)benzamide;prop-1-ene |
|---|---|
| PubChem CID | 142009385 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-(1-methylpiperidin-4-yl)-2-(trifluoromethyl)benzamide;prop-1-ene |
| SMILES | C=CC.CN1CCC(NC(=O)c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H17F3N2O.C3H6/c1-19-8-6-10(7-9-19)18-13(20)11-4-2-3-5-12(11)14(15,16)17;1-3-2/h2-5,10H,6-9H2,1H3,(H,18,20);3H,1H2,2H3 |
| InChIKey | OYLKYNJHBPFRHW-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|