C8H7Cl2NO3S — CID 142012463
2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid (PubChem CID 142012463) has the molecular formula C8H7Cl2NO3S and a molecular weight of 268.12 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid.
| Compound Name | 2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid |
|---|---|
| PubChem CID | 142012463 |
| Molecular Formula | C8H7Cl2NO3S |
| Molecular Weight | 268.12 g/mol |
| Exact Mass | 266.95 |
| IUPAC Name | 2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid |
| SMILES | O=C(O)CNSc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C8H7Cl2NO3S/c9-4-1-5(10)8(14)6(2-4)15-11-3-7(12)13/h1-2,11,14H,3H2,(H,12,13) |
| InChIKey | HMTUZJFPNOMQJQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.12 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|