C19H24Cl2N4O5S — CID 142012462
2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine (PubChem CID 142012462) has the molecular formula C19H24Cl2N4O5S and a molecular weight of 491.40 g/mol. Its IUPAC name is 2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine.
| Compound Name | 2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine |
|---|---|
| PubChem CID | 142012462 |
| Molecular Formula | C19H24Cl2N4O5S |
| Molecular Weight | 491.40 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | 2-[(3,5-dichloro-2-hydroxyphenyl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine |
| SMILES | Cc1ccc(OCCCON=C(N)N)cc1.O=C(O)CNSc1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C11H17N3O2.C8H7Cl2NO3S/c1-9-3-5-10(6-4-9)15-7-2-8-16-14-11(12)13;9-4-1-5(10)8(14)6(2-4)15-11-3-7(12)13/h3-6H,2,7-8H2,1H3,(H4,12,13,14);1-2,11,14H,3H2,(H,12,13) |
| InChIKey | ZWGLCXIZMQKHCP-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 152.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.40 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|