C17H23ClN4O4S2 — CID 142012504
2-[(5-chlorothiophen-2-yl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine (PubChem CID 142012504) has the molecular formula C17H23ClN4O4S2 and a molecular weight of 446.98 g/mol. Its IUPAC name is 2-[(5-chlorothiophen-2-yl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine.
| Compound Name | 2-[(5-chlorothiophen-2-yl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine |
|---|---|
| PubChem CID | 142012504 |
| Molecular Formula | C17H23ClN4O4S2 |
| Molecular Weight | 446.98 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 2-[(5-chlorothiophen-2-yl)sulfanylamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine |
| SMILES | Cc1ccc(OCCCON=C(N)N)cc1.O=C(O)CNSc1ccc(Cl)s1 |
| InChI | InChI=1S/C11H17N3O2.C6H6ClNO2S2/c1-9-3-5-10(6-4-9)15-7-2-8-16-14-11(12)13;7-4-1-2-6(11-4)12-8-3-5(9)10/h3-6H,2,7-8H2,1H3,(H4,12,13,14);1-2,8H,3H2,(H,9,10) |
| InChIKey | ORAFXAWZZHXGJA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 132.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.98 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|