C22H34FN5O5S2 — CID 142012466
2-[(2-ethyl-4-fluoro-N-methylanilino)sulfanyloxyamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine;sulfane (PubChem CID 142012466) has the molecular formula C22H34FN5O5S2 and a molecular weight of 531.68 g/mol. Its IUPAC name is 2-[(2-ethyl-4-fluoro-N-methylanilino)sulfanyloxyamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine;sulfane.
| Compound Name | 2-[(2-ethyl-4-fluoro-N-methylanilino)sulfanyloxyamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine;sulfane |
|---|---|
| PubChem CID | 142012466 |
| Molecular Formula | C22H34FN5O5S2 |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.20 |
| IUPAC Name | 2-[(2-ethyl-4-fluoro-N-methylanilino)sulfanyloxyamino]acetic acid;2-[3-(4-methylphenoxy)propoxy]guanidine;sulfane |
| SMILES | CCc1cc(F)ccc1N(C)SONCC(=O)O.Cc1ccc(OCCCON=C(N)N)cc1.S |
| InChI | InChI=1S/C11H15FN2O3S.C11H17N3O2.H2S/c1-3-8-6-9(12)4-5-10(8)14(2)18-17-13-7-11(15)16;1-9-3-5-10(6-4-9)15-7-2-8-16-14-11(12)13;/h4-6,13H,3,7H2,1-2H3,(H,15,16);3-6H,2,7-8H2,1H3,(H4,12,13,14);1H2 |
| InChIKey | HTNIPIJVMWLAEM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|