C8H9NO4S — CID 162681506
2-[(3,4-dihydroxyphenyl)sulfanylamino]acetic acid (PubChem CID 162681506) has the molecular formula C8H9NO4S and a molecular weight of 215.23 g/mol. Its IUPAC name is 2-[(3,4-dihydroxyphenyl)sulfanylamino]acetic acid.
| Compound Name | 2-[(3,4-dihydroxyphenyl)sulfanylamino]acetic acid |
|---|---|
| PubChem CID | 162681506 |
| Molecular Formula | C8H9NO4S |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.03 |
| IUPAC Name | 2-[(3,4-dihydroxyphenyl)sulfanylamino]acetic acid |
| SMILES | O=C(O)CNSc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C8H9NO4S/c10-6-2-1-5(3-7(6)11)14-9-4-8(12)13/h1-3,9-11H,4H2,(H,12,13) |
| InChIKey | ZZKATEXIZXZDMV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|