C22H42O — CID 142016468
ethane;3-ethyl-2,7,8-trimethylspiro[4.4]nona-2,7-diene;2-methoxyprop-1-ene (PubChem CID 142016468) has the molecular formula C22H42O and a molecular weight of 322.58 g/mol. Its IUPAC name is ethane;3-ethyl-2,7,8-trimethylspiro[4.4]nona-2,7-diene;2-methoxyprop-1-ene.
| Compound Name | ethane;3-ethyl-2,7,8-trimethylspiro[4.4]nona-2,7-diene;2-methoxyprop-1-ene |
|---|---|
| PubChem CID | 142016468 |
| Molecular Formula | C22H42O |
| Molecular Weight | 322.58 g/mol |
| Exact Mass | 322.32 |
| IUPAC Name | ethane;3-ethyl-2,7,8-trimethylspiro[4.4]nona-2,7-diene;2-methoxyprop-1-ene |
| SMILES | C=C(C)OC.CC.CC.CCC1=C(C)CC2(CC(C)=C(C)C2)C1 |
| InChI | InChI=1S/C14H22.C4H8O.2C2H6/c1-5-13-9-14(8-12(13)4)6-10(2)11(3)7-14;1-4(2)5-3;2*1-2/h5-9H2,1-4H3;1H2,2-3H3;2*1-2H3 |
| InChIKey | FXCTVUMGIYMZMW-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.58 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|