C11H19NO — CID 142016559
(2S)-1-amino-5-cyclohexa-1,5-dien-1-ylpentan-2-ol (PubChem CID 142016559) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2S)-1-amino-5-cyclohexa-1,5-dien-1-ylpentan-2-ol.
| Compound Name | (2S)-1-amino-5-cyclohexa-1,5-dien-1-ylpentan-2-ol |
|---|---|
| PubChem CID | 142016559 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2S)-1-amino-5-cyclohexa-1,5-dien-1-ylpentan-2-ol |
| SMILES | NC[C@@H](O)CCCC1=CCCC=C1 |
| InChI | InChI=1S/C11H19NO/c12-9-11(13)8-4-7-10-5-2-1-3-6-10/h2,5-6,11,13H,1,3-4,7-9,12H2/t11-/m0/s1 |
| InChIKey | AWWHYCBGPUNUCC-NSHDSACASA-N |
| XLogP | 1.75 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |