C20H30 — CID 142016775
1-[(1R)-1-tert-butyl-4-propan-2-ylcyclohex-2-en-1-yl]-4-methylbenzene (PubChem CID 142016775) has the molecular formula C20H30 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1-[(1R)-1-tert-butyl-4-propan-2-ylcyclohex-2-en-1-yl]-4-methylbenzene.
| Compound Name | 1-[(1R)-1-tert-butyl-4-propan-2-ylcyclohex-2-en-1-yl]-4-methylbenzene |
|---|---|
| PubChem CID | 142016775 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | 1-[(1R)-1-tert-butyl-4-propan-2-ylcyclohex-2-en-1-yl]-4-methylbenzene |
| SMILES | Cc1ccc([C@@]2(C(C)(C)C)C=CC(C(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H30/c1-15(2)17-11-13-20(14-12-17,19(4,5)6)18-9-7-16(3)8-10-18/h7-11,13,15,17H,12,14H2,1-6H3/t17?,20-/m1/s1 |
| InChIKey | SGAHYQONIYSMFE-UUSAFJCLSA-N |
| XLogP | 5.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|