C10H19N3O — CID 142017865
1,4-dimethylimidazole;4-methylmorpholine (PubChem CID 142017865) has the molecular formula C10H19N3O and a molecular weight of 197.28 g/mol. Its IUPAC name is 1,4-dimethylimidazole;4-methylmorpholine.
| Compound Name | 1,4-dimethylimidazole;4-methylmorpholine |
|---|---|
| PubChem CID | 142017865 |
| Molecular Formula | C10H19N3O |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.15 |
| IUPAC Name | 1,4-dimethylimidazole;4-methylmorpholine |
| SMILES | CN1CCOCC1.Cc1cn(C)cn1 |
| InChI | InChI=1S/C5H8N2.C5H11NO/c1-5-3-7(2)4-6-5;1-6-2-4-7-5-3-6/h3-4H,1-2H3;2-5H2,1H3 |
| InChIKey | LZSUVUDAAKMQRY-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |