About 1,4-dimethylimidazole;ethane;quinoline
1,4-dimethylimidazole;ethane;quinoline (PubChem CID 90996205) has the molecular formula C16H21N3
and a molecular weight of 255.36 g/mol. Its IUPAC name is 1,4-dimethylimidazole;ethane;quinoline.
Molecular Properties
| Compound Name | 1,4-dimethylimidazole;ethane;quinoline |
| PubChem CID | 90996205 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 1,4-dimethylimidazole;ethane;quinoline |
| SMILES | CC.Cc1cn(C)cn1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.C5H8N2.C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-5-3-7(2)4-6-5;1-2/h1-7H;3-4H,1-2H3;1-2H3 |
| InChIKey | AVCMNCLUYNFLTJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,4-dimethylimidazole;ethane;quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethylimidazole;ethane;quinoline?
The IUPAC name of 1,4-dimethylimidazole;ethane;quinoline (CID 90996205) is 1,4-dimethylimidazole;ethane;quinoline.
What is the SMILES notation for 1,4-dimethylimidazole;ethane;quinoline?
The canonical SMILES for 1,4-dimethylimidazole;ethane;quinoline is CC.Cc1cn(C)cn1.c1ccc2ncccc2c1.
What is the InChIKey of 1,4-dimethylimidazole;ethane;quinoline?
The InChIKey is AVCMNCLUYNFLTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.C5H8N2.C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-5-3-7(2)4-6-5;1-2/h1-7H;3-4H,1-2H3;1-2H3.
What are the key properties of 1,4-dimethylimidazole;ethane;quinoline?
1,4-dimethylimidazole;ethane;quinoline has a molecular weight of 255.36 g/mol, XLogP of 3.99, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethylimidazole;ethane;quinoline is sourced from PubChem (CID 90996205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).