C23H21NO4S2 — CID 14201917
N-[2,4-bis(benzenesulfonyl)cyclobuten-1-yl]-N-methylaniline (PubChem CID 14201917) has the molecular formula C23H21NO4S2 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-[2,4-bis(benzenesulfonyl)cyclobuten-1-yl]-N-methylaniline.
| Compound Name | N-[2,4-bis(benzenesulfonyl)cyclobuten-1-yl]-N-methylaniline |
|---|---|
| PubChem CID | 14201917 |
| Molecular Formula | C23H21NO4S2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | N-[2,4-bis(benzenesulfonyl)cyclobuten-1-yl]-N-methylaniline |
| SMILES | CN(C1=C(S(=O)(=O)c2ccccc2)CC1S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21NO4S2/c1-24(18-11-5-2-6-12-18)23-21(29(25,26)19-13-7-3-8-14-19)17-22(23)30(27,28)20-15-9-4-10-16-20/h2-16,21H,17H2,1H3 |
| InChIKey | FOBYTKQBPXKUGG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |