About N-oxido-3-propylaniline
N-oxido-3-propylaniline (PubChem CID 142022424) has the molecular formula C9H12NO-
and a molecular weight of 150.20 g/mol. Its IUPAC name is N-oxido-3-propylaniline.
Molecular Properties
| Compound Name | N-oxido-3-propylaniline |
| PubChem CID | 142022424 |
| Molecular Formula | C9H12NO- |
| Molecular Weight | 150.20 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | N-oxido-3-propylaniline |
| SMILES | CCCc1cccc(N[O-])c1 |
| InChI | InChI=1S/C9H12NO/c1-2-4-8-5-3-6-9(7-8)10-11/h3,5-7,10H,2,4H2,1H3/q-1 |
| InChIKey | QQQCRDMOOXSZOD-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.20 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-oxido-3-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-oxido-3-propylaniline?
The IUPAC name of N-oxido-3-propylaniline (CID 142022424) is N-oxido-3-propylaniline.
What is the SMILES notation for N-oxido-3-propylaniline?
The canonical SMILES for N-oxido-3-propylaniline is CCCc1cccc(N[O-])c1.
What is the InChIKey of N-oxido-3-propylaniline?
The InChIKey is QQQCRDMOOXSZOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12NO/c1-2-4-8-5-3-6-9(7-8)10-11/h3,5-7,10H,2,4H2,1H3/q-1.
What are the key properties of N-oxido-3-propylaniline?
N-oxido-3-propylaniline has a molecular weight of 150.20 g/mol, XLogP of 2.55, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-oxido-3-propylaniline is sourced from PubChem (CID 142022424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).